C17H22N2O3 — CID 133315183
2-[1-(6-methoxyquinolin-2-yl)piperidin-3-yl]oxyethanol (PubChem CID 133315183) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[1-(6-methoxyquinolin-2-yl)piperidin-3-yl]oxyethanol.
| Compound Name | 2-[1-(6-methoxyquinolin-2-yl)piperidin-3-yl]oxyethanol |
|---|---|
| PubChem CID | 133315183 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[1-(6-methoxyquinolin-2-yl)piperidin-3-yl]oxyethanol |
| SMILES | COc1ccc2nc(N3CCCC(OCCO)C3)ccc2c1 |
| InChI | InChI=1S/C17H22N2O3/c1-21-14-5-6-16-13(11-14)4-7-17(18-16)19-8-2-3-15(12-19)22-10-9-20/h4-7,11,15,20H,2-3,8-10,12H2,1H3 |
| InChIKey | MVADHWJPVUAOCM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |