C16H18ClFN2O2 — CID 133315310
2-[1-(4-chloro-8-fluoroquinolin-7-yl)piperidin-3-yl]oxyethanol (PubChem CID 133315310) has the molecular formula C16H18ClFN2O2 and a molecular weight of 324.78 g/mol. Its IUPAC name is 2-[1-(4-chloro-8-fluoroquinolin-7-yl)piperidin-3-yl]oxyethanol.
| Compound Name | 2-[1-(4-chloro-8-fluoroquinolin-7-yl)piperidin-3-yl]oxyethanol |
|---|---|
| PubChem CID | 133315310 |
| Molecular Formula | C16H18ClFN2O2 |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[1-(4-chloro-8-fluoroquinolin-7-yl)piperidin-3-yl]oxyethanol |
| SMILES | OCCOC1CCCN(c2ccc3c(Cl)ccnc3c2F)C1 |
| InChI | InChI=1S/C16H18ClFN2O2/c17-13-5-6-19-16-12(13)3-4-14(15(16)18)20-7-1-2-11(10-20)22-9-8-21/h3-6,11,21H,1-2,7-10H2 |
| InChIKey | QWCWWKBXQBUROF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |