C19H27N5O — CID 133315488
6-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-N-prop-2-ynylpyridine-3-carboxamide (PubChem CID 133315488) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 6-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-N-prop-2-ynylpyridine-3-carboxamide.
| Compound Name | 6-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-N-prop-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133315488 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 6-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-N-prop-2-ynylpyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(N2CCN(C3CCCN(C)C3)CC2)nc1 |
| InChI | InChI=1S/C19H27N5O/c1-3-8-20-19(25)16-6-7-18(21-14-16)24-12-10-23(11-13-24)17-5-4-9-22(2)15-17/h1,6-7,14,17H,4-5,8-13,15H2,2H3,(H,20,25) |
| InChIKey | HUHCPFCQKYDXFD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|