About N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide
N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 133316515) has the molecular formula C20H20N4O2S
and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide |
| PubChem CID | 133316515 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c2ncc(C#N)c(NCCNS(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C20H20N4O2S/c1-14-10-15(2)19-18(11-14)20(16(12-21)13-23-19)22-8-9-24-27(25,26)17-6-4-3-5-7-17/h3-7,10-11,13,24H,8-9H2,1-2H3,(H,22,23) |
| InChIKey | XEUUOFCIQXMUKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide?
The IUPAC name of N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide (CID 133316515) is N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide.
What is the SMILES notation for N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide?
The canonical SMILES for N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide is Cc1cc(C)c2ncc(C#N)c(NCCNS(=O)(=O)c3ccccc3)c2c1.
What is the InChIKey of N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide?
The InChIKey is XEUUOFCIQXMUKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O2S/c1-14-10-15(2)19-18(11-14)20(16(12-21)13-23-19)22-8-9-24-27(25,26)17-6-4-3-5-7-17/h3-7,10-11,13,24H,8-9H2,1-2H3,(H,22,23).
What are the key properties of N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide?
N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide has a molecular weight of 380.47 g/mol, XLogP of 3.11, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3-cyano-6,8-dimethylquinolin-4-yl)amino]ethyl]benzenesulfonamide is sourced from PubChem (CID 133316515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).