C22H27N5O2 — CID 133316627
6,7-dimethoxy-2-N-(1-phenyl-2-pyrrolidin-1-ylethyl)quinazoline-2,4-diamine (PubChem CID 133316627) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-(1-phenyl-2-pyrrolidin-1-ylethyl)quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N-(1-phenyl-2-pyrrolidin-1-ylethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 133316627 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 6,7-dimethoxy-2-N-(1-phenyl-2-pyrrolidin-1-ylethyl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(NC(CN3CCCC3)c3ccccc3)nc(N)c2cc1OC |
| InChI | InChI=1S/C22H27N5O2/c1-28-19-12-16-17(13-20(19)29-2)24-22(26-21(16)23)25-18(14-27-10-6-7-11-27)15-8-4-3-5-9-15/h3-5,8-9,12-13,18H,6-7,10-11,14H2,1-2H3,(H3,23,24,25,26) |
| InChIKey | JMJNKWQCOFIQCC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |