About 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one
3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one (PubChem CID 133318497) has the molecular formula C22H25N3O5
and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one |
| PubChem CID | 133318497 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(OC2CCN(c3ccc([N+](=O)[O-])cc3N3CCOC3=O)CC2)cc1C |
| InChI | InChI=1S/C22H25N3O5/c1-15-3-5-19(13-16(15)2)30-18-7-9-23(10-8-18)20-6-4-17(25(27)28)14-21(20)24-11-12-29-22(24)26/h3-6,13-14,18H,7-12H2,1-2H3 |
| InChIKey | YVWPLIRNNJDXPV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one (CID 133318497) is 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one is Cc1ccc(OC2CCN(c3ccc([N+](=O)[O-])cc3N3CCOC3=O)CC2)cc1C.
What is the InChIKey of 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one?
The InChIKey is YVWPLIRNNJDXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O5/c1-15-3-5-19(13-16(15)2)30-18-7-9-23(10-8-18)20-6-4-17(25(27)28)14-21(20)24-11-12-29-22(24)26/h3-6,13-14,18H,7-12H2,1-2H3.
What are the key properties of 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one?
3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one has a molecular weight of 411.46 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-5-nitrophenyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 133318497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).