C15H17ClN4O — CID 133319615
3-chloro-2-[4-(2-oxoimidazolidin-1-yl)piperidin-1-yl]benzonitrile (PubChem CID 133319615) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 3-chloro-2-[4-(2-oxoimidazolidin-1-yl)piperidin-1-yl]benzonitrile.
| Compound Name | 3-chloro-2-[4-(2-oxoimidazolidin-1-yl)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133319615 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-chloro-2-[4-(2-oxoimidazolidin-1-yl)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1cccc(Cl)c1N1CCC(N2CCNC2=O)CC1 |
| InChI | InChI=1S/C15H17ClN4O/c16-13-3-1-2-11(10-17)14(13)19-7-4-12(5-8-19)20-9-6-18-15(20)21/h1-3,12H,4-9H2,(H,18,21) |
| InChIKey | CUYDWGSPDIBXSA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |