C13H14BrN3O2S — CID 133320992
2-bromo-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-nitroaniline (PubChem CID 133320992) has the molecular formula C13H14BrN3O2S and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-nitroaniline.
| Compound Name | 2-bromo-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 133320992 |
| Molecular Formula | C13H14BrN3O2S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-bromo-N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-nitroaniline |
| SMILES | Cc1nc(C)c(CCNc2ccc([N+](=O)[O-])cc2Br)s1 |
| InChI | InChI=1S/C13H14BrN3O2S/c1-8-13(20-9(2)16-8)5-6-15-12-4-3-10(17(18)19)7-11(12)14/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | UOYKJHIZCQNCMS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|