About (6E)-8-methoxy-3,6-dimethylocta-1,6-diene
(6E)-8-methoxy-3,6-dimethylocta-1,6-diene (PubChem CID 13332107) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (6E)-8-methoxy-3,6-dimethylocta-1,6-diene.
Molecular Properties
| Compound Name | (6E)-8-methoxy-3,6-dimethylocta-1,6-diene |
| PubChem CID | 13332107 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (6E)-8-methoxy-3,6-dimethylocta-1,6-diene |
| SMILES | C=CC(C)CC/C(C)=C/COC |
| InChI | InChI=1S/C11H20O/c1-5-10(2)6-7-11(3)8-9-12-4/h5,8,10H,1,6-7,9H2,2-4H3/b11-8+ |
| InChIKey | OWUCZSYIAXDZSD-DHZHZOJOSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-8-methoxy-3,6-dimethylocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-8-methoxy-3,6-dimethylocta-1,6-diene?
The IUPAC name of (6E)-8-methoxy-3,6-dimethylocta-1,6-diene (CID 13332107) is (6E)-8-methoxy-3,6-dimethylocta-1,6-diene.
What is the SMILES notation for (6E)-8-methoxy-3,6-dimethylocta-1,6-diene?
The canonical SMILES for (6E)-8-methoxy-3,6-dimethylocta-1,6-diene is C=CC(C)CC/C(C)=C/COC.
What is the InChIKey of (6E)-8-methoxy-3,6-dimethylocta-1,6-diene?
The InChIKey is OWUCZSYIAXDZSD-DHZHZOJOSA-N. The full InChI is InChI=1S/C11H20O/c1-5-10(2)6-7-11(3)8-9-12-4/h5,8,10H,1,6-7,9H2,2-4H3/b11-8+.
What are the key properties of (6E)-8-methoxy-3,6-dimethylocta-1,6-diene?
(6E)-8-methoxy-3,6-dimethylocta-1,6-diene has a molecular weight of 168.28 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-8-methoxy-3,6-dimethylocta-1,6-diene is sourced from PubChem (CID 13332107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).