C17H18F3N5S2 — CID 133321439
4-ethyl-3-[1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidin-4-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 133321439) has the molecular formula C17H18F3N5S2 and a molecular weight of 413.49 g/mol. Its IUPAC name is 4-ethyl-3-[1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidin-4-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidin-4-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 133321439 |
| Molecular Formula | C17H18F3N5S2 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-ethyl-3-[1-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidin-4-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(C2CCN(c3nc4cc(C(F)(F)F)ccc4s3)CC2)n[nH]c1=S |
| InChI | InChI=1S/C17H18F3N5S2/c1-2-25-14(22-23-15(25)26)10-5-7-24(8-6-10)16-21-12-9-11(17(18,19)20)3-4-13(12)27-16/h3-4,9-10H,2,5-8H2,1H3,(H,23,26) |
| InChIKey | AIUSCAGOQQBMIX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|