C19H18FN5O3 — CID 133322767
2-[4-(2-fluoroanilino)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133322767) has the molecular formula C19H18FN5O3 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-[4-(2-fluoroanilino)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[4-(2-fluoroanilino)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133322767 |
| Molecular Formula | C19H18FN5O3 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[4-(2-fluoroanilino)piperidin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(N2CCC(Nc3ccccc3F)CC2)nc2ccccn12 |
| InChI | InChI=1S/C19H18FN5O3/c20-14-5-1-2-6-15(14)21-13-8-11-23(12-9-13)18-17(25(27)28)19(26)24-10-4-3-7-16(24)22-18/h1-7,10,13,21H,8-9,11-12H2 |
| InChIKey | NRUKWOMFZQHZME-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|