C15H17F3N2O2S — CID 133322846
4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 133322846) has the molecular formula C15H17F3N2O2S and a molecular weight of 346.37 g/mol. Its IUPAC name is 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133322846 |
| Molecular Formula | C15H17F3N2O2S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CC3CC=CCC3C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O2S/c16-15(17,18)13-7-12(23(19,21)22)5-6-14(13)20-8-10-3-1-2-4-11(10)9-20/h1-2,5-7,10-11H,3-4,8-9H2,(H2,19,21,22) |
| InChIKey | BIUJJYTWQKTIDI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|