C18H17N3 — CID 133322880
4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)quinoline-2-carbonitrile (PubChem CID 133322880) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)quinoline-2-carbonitrile.
| Compound Name | 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 133322880 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)quinoline-2-carbonitrile |
| SMILES | N#Cc1cc(N2CC3CC=CCC3C2)c2ccccc2n1 |
| InChI | InChI=1S/C18H17N3/c19-10-15-9-18(16-7-3-4-8-17(16)20-15)21-11-13-5-1-2-6-14(13)12-21/h1-4,7-9,13-14H,5-6,11-12H2 |
| InChIKey | UBEUKTCEWWKYAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|