C18H17F3N4 — CID 133322882
2-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 133322882) has the molecular formula C18H17F3N4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 133322882 |
| Molecular Formula | C18H17F3N4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | FC(F)(F)c1cc(N2CC3CC=CCC3C2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C18H17F3N4/c19-18(20,21)15-9-16(24-17(23-15)12-5-7-22-8-6-12)25-10-13-3-1-2-4-14(13)11-25/h1-2,5-9,13-14H,3-4,10-11H2 |
| InChIKey | BTKYKRZRFFRJMB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|