C13H15BrN2 — CID 133322900
2-(5-bromo-3-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 133322900) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 133322900 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | Brc1cncc(N2CC3CC=CCC3C2)c1 |
| InChI | InChI=1S/C13H15BrN2/c14-12-5-13(7-15-6-12)16-8-10-3-1-2-4-11(10)9-16/h1-2,5-7,10-11H,3-4,8-9H2 |
| InChIKey | AJWUHBPJTSLHJI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|