About 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline
2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline (PubChem CID 133322934) has the molecular formula C17H21F2N3
and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline |
| PubChem CID | 133322934 |
| Molecular Formula | C17H21F2N3 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline |
| SMILES | CC1(C)CCCN(c2nc(C(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C17H21F2N3/c1-17(2)8-5-10-22(11-9-17)16-12-6-3-4-7-13(12)20-15(21-16)14(18)19/h3-4,6-7,14H,5,8-11H2,1-2H3 |
| InChIKey | DUYILWINDTVRSG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline?
The IUPAC name of 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline (CID 133322934) is 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline.
What is the SMILES notation for 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline?
The canonical SMILES for 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline is CC1(C)CCCN(c2nc(C(F)F)nc3ccccc23)CC1.
What is the InChIKey of 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline?
The InChIKey is DUYILWINDTVRSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3/c1-17(2)8-5-10-22(11-9-17)16-12-6-3-4-7-13(12)20-15(21-16)14(18)19/h3-4,6-7,14H,5,8-11H2,1-2H3.
What are the key properties of 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline?
2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline has a molecular weight of 305.37 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)quinazoline is sourced from PubChem (CID 133322934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).