C18H16Cl3N3O — CID 133322993
2-[4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one (PubChem CID 133322993) has the molecular formula C18H16Cl3N3O and a molecular weight of 396.71 g/mol. Its IUPAC name is 2-[4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one.
| Compound Name | 2-[4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 133322993 |
| Molecular Formula | C18H16Cl3N3O |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[4-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-3-chlorophenyl]-4,5-dichloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(N2CC3CC=CCC3C2)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl3N3O/c19-14-7-13(24-18(25)17(21)15(20)8-22-24)5-6-16(14)23-9-11-3-1-2-4-12(11)10-23/h1-2,5-8,11-12H,3-4,9-10H2 |
| InChIKey | PCFWQQJLZJWZMS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|