About 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole
5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole (PubChem CID 133323324) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole |
| PubChem CID | 133323324 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(N2CCCC(C)(C)CC2)n1 |
| InChI | InChI=1S/C11H19N3S/c1-9-12-10(15-13-9)14-7-4-5-11(2,3)6-8-14/h4-8H2,1-3H3 |
| InChIKey | BEKRVBYNIZUCRF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole?
The IUPAC name of 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole (CID 133323324) is 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole.
What is the SMILES notation for 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole?
The canonical SMILES for 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole is Cc1nsc(N2CCCC(C)(C)CC2)n1.
What is the InChIKey of 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole?
The InChIKey is BEKRVBYNIZUCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c1-9-12-10(15-13-9)14-7-4-5-11(2,3)6-8-14/h4-8H2,1-3H3.
What are the key properties of 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole?
5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole has a molecular weight of 225.36 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethylazepan-1-yl)-3-methyl-1,2,4-thiadiazole is sourced from PubChem (CID 133323324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).