C11H13N5O3 — CID 133323532
1-(1-methylpyrazol-4-yl)-2-[(3-nitro-2-pyridinyl)amino]ethanol (PubChem CID 133323532) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-2-[(3-nitro-2-pyridinyl)amino]ethanol.
| Compound Name | 1-(1-methylpyrazol-4-yl)-2-[(3-nitro-2-pyridinyl)amino]ethanol |
|---|---|
| PubChem CID | 133323532 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-2-[(3-nitro-2-pyridinyl)amino]ethanol |
| SMILES | Cn1cc(C(O)CNc2ncccc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H13N5O3/c1-15-7-8(5-14-15)10(17)6-13-11-9(16(18)19)3-2-4-12-11/h2-5,7,10,17H,6H2,1H3,(H,12,13) |
| InChIKey | AREUSKRHRUBYRX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|