About 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene
4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene (PubChem CID 133324014) has the molecular formula C14H12Cl2O4S3
and a molecular weight of 411.35 g/mol. Its IUPAC name is 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene |
| PubChem CID | 133324014 |
| Molecular Formula | C14H12Cl2O4S3 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene |
| SMILES | CS(=O)(=O)c1ccc(Sc2ccc(Cl)c(Cl)c2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H12Cl2O4S3/c1-22(17,18)10-4-6-13(14(8-10)23(2,19)20)21-9-3-5-11(15)12(16)7-9/h3-8H,1-2H3 |
| InChIKey | WONMTHNSIXDAJX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene?
The IUPAC name of 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene (CID 133324014) is 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene.
What is the SMILES notation for 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene?
The canonical SMILES for 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene is CS(=O)(=O)c1ccc(Sc2ccc(Cl)c(Cl)c2)c(S(C)(=O)=O)c1.
What is the InChIKey of 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene?
The InChIKey is WONMTHNSIXDAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2O4S3/c1-22(17,18)10-4-6-13(14(8-10)23(2,19)20)21-9-3-5-11(15)12(16)7-9/h3-8H,1-2H3.
What are the key properties of 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene?
4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene has a molecular weight of 411.35 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-bis(methylsulfonyl)phenyl]sulfanyl-1,2-dichlorobenzene is sourced from PubChem (CID 133324014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).