C10H21N — CID 13332418
2,2-dipropylpyrrolidine (PubChem CID 13332418) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 2,2-dipropylpyrrolidine.
| Compound Name | 2,2-dipropylpyrrolidine |
|---|---|
| PubChem CID | 13332418 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 2,2-dipropylpyrrolidine |
| SMILES | CCCC1(CCC)CCCN1 |
| InChI | InChI=1S/C10H21N/c1-3-6-10(7-4-2)8-5-9-11-10/h11H,3-9H2,1-2H3 |
| InChIKey | RCDUVHIXLKAHCE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |