About 2,2-dibutylpiperidine
2,2-dibutylpiperidine (PubChem CID 13332422) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 2,2-dibutylpiperidine.
Molecular Properties
| Compound Name | 2,2-dibutylpiperidine |
| PubChem CID | 13332422 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 2,2-dibutylpiperidine |
| SMILES | CCCCC1(CCCC)CCCCN1 |
| InChI | InChI=1S/C13H27N/c1-3-5-9-13(10-6-4-2)11-7-8-12-14-13/h14H,3-12H2,1-2H3 |
| InChIKey | UNZJSUUXGVQCOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dibutylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutylpiperidine?
The IUPAC name of 2,2-dibutylpiperidine (CID 13332422) is 2,2-dibutylpiperidine.
What is the SMILES notation for 2,2-dibutylpiperidine?
The canonical SMILES for 2,2-dibutylpiperidine is CCCCC1(CCCC)CCCCN1.
What is the InChIKey of 2,2-dibutylpiperidine?
The InChIKey is UNZJSUUXGVQCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-3-5-9-13(10-6-4-2)11-7-8-12-14-13/h14H,3-12H2,1-2H3.
What are the key properties of 2,2-dibutylpiperidine?
2,2-dibutylpiperidine has a molecular weight of 197.37 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutylpiperidine is sourced from PubChem (CID 13332422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).