About 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine
1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine (PubChem CID 133324361) has the molecular formula C19H22FNO4S2
and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine.
Molecular Properties
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine |
| PubChem CID | 133324361 |
| Molecular Formula | C19H22FNO4S2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine |
| SMILES | CC1CC(c2ccccc2F)N(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H22FNO4S2/c1-13-10-18(15-6-4-5-7-16(15)20)21(12-13)17-9-8-14(26(2,22)23)11-19(17)27(3,24)25/h4-9,11,13,18H,10,12H2,1-3H3 |
| InChIKey | NJGKBHNRGWXIMT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine?
The IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine (CID 133324361) is 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine.
What is the SMILES notation for 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine?
The canonical SMILES for 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine is CC1CC(c2ccccc2F)N(c2ccc(S(C)(=O)=O)cc2S(C)(=O)=O)C1.
What is the InChIKey of 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine?
The InChIKey is NJGKBHNRGWXIMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNO4S2/c1-13-10-18(15-6-4-5-7-16(15)20)21(12-13)17-9-8-14(26(2,22)23)11-19(17)27(3,24)25/h4-9,11,13,18H,10,12H2,1-3H3.
What are the key properties of 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine?
1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine has a molecular weight of 411.52 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(methylsulfonyl)phenyl]-2-(2-fluorophenyl)-4-methylpyrrolidine is sourced from PubChem (CID 133324361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).