C20H20N6 — CID 133325348
4-phenyl-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-2-amine (PubChem CID 133325348) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-phenyl-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-2-amine.
| Compound Name | 4-phenyl-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 133325348 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-phenyl-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-2-amine |
| SMILES | c1ccc(-c2nc(NCCCCn3cnnc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C20H20N6/c1-2-8-16(9-3-1)19-17-10-4-5-11-18(17)24-20(25-19)21-12-6-7-13-26-14-22-23-15-26/h1-5,8-11,14-15H,6-7,12-13H2,(H,21,24,25) |
| InChIKey | PLDRDYIWQAGTMZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|