About 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine
6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine (PubChem CID 133325400) has the molecular formula C14H15FN6
and a molecular weight of 286.31 g/mol. Its IUPAC name is 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine |
| PubChem CID | 133325400 |
| Molecular Formula | C14H15FN6 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NCCCCn3cnnc3)c2c1 |
| InChI | InChI=1S/C14H15FN6/c15-11-3-4-13-12(7-11)14(18-8-17-13)16-5-1-2-6-21-9-19-20-10-21/h3-4,7-10H,1-2,5-6H2,(H,16,17,18) |
| InChIKey | WMYJGFGAHNRVOO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine?
The IUPAC name of 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine (CID 133325400) is 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine.
What is the SMILES notation for 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine?
The canonical SMILES for 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine is Fc1ccc2ncnc(NCCCCn3cnnc3)c2c1.
What is the InChIKey of 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine?
The InChIKey is WMYJGFGAHNRVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN6/c15-11-3-4-13-12(7-11)14(18-8-17-13)16-5-1-2-6-21-9-19-20-10-21/h3-4,7-10H,1-2,5-6H2,(H,16,17,18).
What are the key properties of 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine?
6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine has a molecular weight of 286.31 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-[4-(1,2,4-triazol-4-yl)butyl]quinazolin-4-amine is sourced from PubChem (CID 133325400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).