About N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine
N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 133325814) has the molecular formula C21H16F2N2O2S2
and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine |
| PubChem CID | 133325814 |
| Molecular Formula | C21H16F2N2O2S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | CS(=O)(=O)c1cccc(C(Nc2ccnc3ccsc23)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C21H16F2N2O2S2/c1-29(26,27)15-4-2-3-13(11-15)20(14-5-6-16(22)17(23)12-14)25-19-7-9-24-18-8-10-28-21(18)19/h2-12,20H,1H3,(H,24,25) |
| InChIKey | FVVZCNDZTDSBDM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine?
The IUPAC name of N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine (CID 133325814) is N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine?
The canonical SMILES for N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine is CS(=O)(=O)c1cccc(C(Nc2ccnc3ccsc23)c2ccc(F)c(F)c2)c1.
What is the InChIKey of N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine?
The InChIKey is FVVZCNDZTDSBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N2O2S2/c1-29(26,27)15-4-2-3-13(11-15)20(14-5-6-16(22)17(23)12-14)25-19-7-9-24-18-8-10-28-21(18)19/h2-12,20H,1H3,(H,24,25).
What are the key properties of N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine?
N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine has a molecular weight of 430.50 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methyl]thieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 133325814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).