C16H19N3O2 — CID 133326631
methyl (3S)-1-(3-methylquinoxalin-2-yl)piperidine-3-carboxylate (PubChem CID 133326631) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is methyl (3S)-1-(3-methylquinoxalin-2-yl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(3-methylquinoxalin-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 133326631 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | methyl (3S)-1-(3-methylquinoxalin-2-yl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(c2nc3ccccc3nc2C)C1 |
| InChI | InChI=1S/C16H19N3O2/c1-11-15(18-14-8-4-3-7-13(14)17-11)19-9-5-6-12(10-19)16(20)21-2/h3-4,7-8,12H,5-6,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | RRDJFYKKLKUIRT-LBPRGKRZSA-N |
| XLogP | 2.33 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |