C13H19N5OS2 — CID 133326859
2,2-dimethyl-N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]propanamide (PubChem CID 133326859) has the molecular formula C13H19N5OS2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 133326859 |
| Molecular Formula | C13H19N5OS2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2,2-dimethyl-N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]propanamide |
| SMILES | CSc1nc2ncnc(NCCNC(=O)C(C)(C)C)c2s1 |
| InChI | InChI=1S/C13H19N5OS2/c1-13(2,3)11(19)15-6-5-14-9-8-10(17-7-16-9)18-12(20-4)21-8/h7H,5-6H2,1-4H3,(H,15,19)(H,14,16,17) |
| InChIKey | HGRYEXHHMFBSTK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|