C14H12Cl2N4OS — CID 133327213
3-(3,5-dichlorophenyl)-6-(2-methoxyethylsulfanyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 133327213) has the molecular formula C14H12Cl2N4OS and a molecular weight of 355.25 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-6-(2-methoxyethylsulfanyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-(3,5-dichlorophenyl)-6-(2-methoxyethylsulfanyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 133327213 |
| Molecular Formula | C14H12Cl2N4OS |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-6-(2-methoxyethylsulfanyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COCCSc1ccc2nnc(-c3cc(Cl)cc(Cl)c3)n2n1 |
| InChI | InChI=1S/C14H12Cl2N4OS/c1-21-4-5-22-13-3-2-12-17-18-14(20(12)19-13)9-6-10(15)8-11(16)7-9/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | MAAXFLZKDWWCGK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|