C20H21FN8S — CID 133328479
3-ethyl-5-[4-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole (PubChem CID 133328479) has the molecular formula C20H21FN8S and a molecular weight of 424.51 g/mol. Its IUPAC name is 3-ethyl-5-[4-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-[4-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133328479 |
| Molecular Formula | C20H21FN8S |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-ethyl-5-[4-[3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-1,4-diazepan-1-yl]-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CCCN(c3ccc4nnc(-c5ccccc5F)n4n3)CC2)n1 |
| InChI | InChI=1S/C20H21FN8S/c1-2-16-22-20(30-26-16)28-11-5-10-27(12-13-28)18-9-8-17-23-24-19(29(17)25-18)14-6-3-4-7-15(14)21/h3-4,6-9H,2,5,10-13H2,1H3 |
| InChIKey | WATRZRBQQSKIDJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |