C18H21F3N2O2S2 — CID 133329341
4-[1-(4-propan-2-ylsulfanylphenyl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133329341) has the molecular formula C18H21F3N2O2S2 and a molecular weight of 418.51 g/mol. Its IUPAC name is 4-[1-(4-propan-2-ylsulfanylphenyl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[1-(4-propan-2-ylsulfanylphenyl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133329341 |
| Molecular Formula | C18H21F3N2O2S2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[1-(4-propan-2-ylsulfanylphenyl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)Sc1ccc(C(C)Nc2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H21F3N2O2S2/c1-11(2)26-15-7-4-13(5-8-15)12(3)23-14-6-9-17(27(22,24)25)16(10-14)18(19,20)21/h4-12,23H,1-3H3,(H2,22,24,25) |
| InChIKey | KPIRGRNTWPKBPC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |