C15H22F3N3O3S — CID 133329434
4-(3-morpholin-4-ylbutan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133329434) has the molecular formula C15H22F3N3O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is 4-(3-morpholin-4-ylbutan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-(3-morpholin-4-ylbutan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133329434 |
| Molecular Formula | C15H22F3N3O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-(3-morpholin-4-ylbutan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(Nc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1)C(C)N1CCOCC1 |
| InChI | InChI=1S/C15H22F3N3O3S/c1-10(11(2)21-5-7-24-8-6-21)20-12-3-4-14(25(19,22)23)13(9-12)15(16,17)18/h3-4,9-11,20H,5-8H2,1-2H3,(H2,19,22,23) |
| InChIKey | DJCFKWXSMZFJNZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |