C15H20N6O2 — CID 133329602
1-[(1-methylimidazol-2-yl)methyl]-4-(4-methyl-5-nitro-2-pyridinyl)piperazine (PubChem CID 133329602) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-4-(4-methyl-5-nitro-2-pyridinyl)piperazine.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-4-(4-methyl-5-nitro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 133329602 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-4-(4-methyl-5-nitro-2-pyridinyl)piperazine |
| SMILES | Cc1cc(N2CCN(Cc3nccn3C)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N6O2/c1-12-9-14(17-10-13(12)21(22)23)20-7-5-19(6-8-20)11-15-16-3-4-18(15)2/h3-4,9-10H,5-8,11H2,1-2H3 |
| InChIKey | FQDZJVHBLNFXKC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|