C19H18F2N6O — CID 1333301
2-N,4-N-bis(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 1333301) has the molecular formula C19H18F2N6O and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-N,4-N-bis(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1333301 |
| Molecular Formula | C19H18F2N6O |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-N,4-N-bis(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1ccc(Nc2nc(Nc3ccc(F)cc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C19H18F2N6O/c20-13-1-5-15(6-2-13)22-17-24-18(23-16-7-3-14(21)4-8-16)26-19(25-17)27-9-11-28-12-10-27/h1-8H,9-12H2,(H2,22,23,24,25,26) |
| InChIKey | VQZSWCFNXLJCBU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |