C21H19ClFN5O3 — CID 133330827
4-chloro-5-[4-(2-fluoroanilino)piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133330827) has the molecular formula C21H19ClFN5O3 and a molecular weight of 443.87 g/mol. Its IUPAC name is 4-chloro-5-[4-(2-fluoroanilino)piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[4-(2-fluoroanilino)piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133330827 |
| Molecular Formula | C21H19ClFN5O3 |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 4-chloro-5-[4-(2-fluoroanilino)piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCC(Nc3ccccc3F)CC2)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19ClFN5O3/c22-20-19(13-24-27(21(20)29)15-5-7-16(8-6-15)28(30)31)26-11-9-14(10-12-26)25-18-4-2-1-3-17(18)23/h1-8,13-14,25H,9-12H2 |
| InChIKey | JEJLMWQRVDOILX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|