About 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine
7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine (PubChem CID 133331902) has the molecular formula C15H20N2O2S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine |
| PubChem CID | 133331902 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine |
| SMILES | COCCOCC1CCN(c2ccnc3ccsc23)C1 |
| InChI | InChI=1S/C15H20N2O2S/c1-18-7-8-19-11-12-3-6-17(10-12)14-2-5-16-13-4-9-20-15(13)14/h2,4-5,9,12H,3,6-8,10-11H2,1H3 |
| InChIKey | XGERXIZLUVIGCH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine?
The IUPAC name of 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine (CID 133331902) is 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine.
What is the SMILES notation for 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine?
The canonical SMILES for 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine is COCCOCC1CCN(c2ccnc3ccsc23)C1.
What is the InChIKey of 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine?
The InChIKey is XGERXIZLUVIGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2S/c1-18-7-8-19-11-12-3-6-17(10-12)14-2-5-16-13-4-9-20-15(13)14/h2,4-5,9,12H,3,6-8,10-11H2,1H3.
What are the key properties of 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine?
7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine has a molecular weight of 292.40 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]thieno[3,2-b]pyridine is sourced from PubChem (CID 133331902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).