About [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol
[4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol (PubChem CID 133332456) has the molecular formula C21H26N4O5
and a molecular weight of 414.46 g/mol. Its IUPAC name is [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol.
Molecular Properties
| Compound Name | [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol |
| PubChem CID | 133332456 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(N2CCC(C)N(Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N4O5/c1-15-8-9-22(10-11-23(15)13-17-6-4-3-5-7-17)21-19(24(27)28)12-18(14-26)16(2)20(21)25(29)30/h3-7,12,15,26H,8-11,13-14H2,1-2H3 |
| InChIKey | YYOYFRBTFAJGIO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol?
The IUPAC name of [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol (CID 133332456) is [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol.
What is the SMILES notation for [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol?
The canonical SMILES for [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol is Cc1c(CO)cc([N+](=O)[O-])c(N2CCC(C)N(Cc3ccccc3)CC2)c1[N+](=O)[O-].
What is the InChIKey of [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol?
The InChIKey is YYOYFRBTFAJGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O5/c1-15-8-9-22(10-11-23(15)13-17-6-4-3-5-7-17)21-19(24(27)28)12-18(14-26)16(2)20(21)25(29)30/h3-7,12,15,26H,8-11,13-14H2,1-2H3.
What are the key properties of [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol?
[4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol has a molecular weight of 414.46 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-benzyl-5-methyl-1,4-diazepan-1-yl)-2-methyl-3,5-dinitrophenyl]methanol is sourced from PubChem (CID 133332456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).