C19H28N4O3 — CID 133333967
methyl 2-[4-[5-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperazin-1-yl]acetate (PubChem CID 133333967) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is methyl 2-[4-[5-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[5-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 133333967 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | methyl 2-[4-[5-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(c2ccc(C(=O)N3CCC(C)CC3)cn2)CC1 |
| InChI | InChI=1S/C19H28N4O3/c1-15-5-7-23(8-6-15)19(25)16-3-4-17(20-13-16)22-11-9-21(10-12-22)14-18(24)26-2/h3-4,13,15H,5-12,14H2,1-2H3 |
| InChIKey | FXUAUYNFDNIILN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |