C18H21N3O4 — CID 133334396
N-(2,6-dimethylphenyl)-2-(3-methoxy-N-methyl-4-nitroanilino)acetamide (PubChem CID 133334396) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(3-methoxy-N-methyl-4-nitroanilino)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(3-methoxy-N-methyl-4-nitroanilino)acetamide |
|---|---|
| PubChem CID | 133334396 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(3-methoxy-N-methyl-4-nitroanilino)acetamide |
| SMILES | COc1cc(N(C)CC(=O)Nc2c(C)cccc2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N3O4/c1-12-6-5-7-13(2)18(12)19-17(22)11-20(3)14-8-9-15(21(23)24)16(10-14)25-4/h5-10H,11H2,1-4H3,(H,19,22) |
| InChIKey | HUWBHOZYPHSFMF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|