C17H19N7O3S — CID 133334788
2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133334788) has the molecular formula C17H19N7O3S and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133334788 |
| Molecular Formula | C17H19N7O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1nsc(N2CCCN(c3nc4ccccn4c(=O)c3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C17H19N7O3S/c1-2-12-18-17(28-20-12)22-8-5-7-21(10-11-22)15-14(24(26)27)16(25)23-9-4-3-6-13(23)19-15/h3-4,6,9H,2,5,7-8,10-11H2,1H3 |
| InChIKey | KDETURAIBYZDIZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|