C16H17N5 — CID 133335271
5-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]pyridine-2-carbonitrile (PubChem CID 133335271) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 5-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]pyridine-2-carbonitrile.
| Compound Name | 5-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133335271 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 5-[(6-pyrrolidin-1-yl-3-pyridinyl)methylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCc2ccc(N3CCCC3)nc2)cn1 |
| InChI | InChI=1S/C16H17N5/c17-9-14-4-5-15(12-19-14)18-10-13-3-6-16(20-11-13)21-7-1-2-8-21/h3-6,11-12,18H,1-2,7-8,10H2 |
| InChIKey | JMFFHFNTOJKUJH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |