C13H15ClN4O2S2 — CID 133335347
3-chloro-N-[2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide (PubChem CID 133335347) has the molecular formula C13H15ClN4O2S2 and a molecular weight of 358.88 g/mol. Its IUPAC name is 3-chloro-N-[2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133335347 |
| Molecular Formula | C13H15ClN4O2S2 |
| Molecular Weight | 358.88 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-chloro-N-[2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1nc(C2CC2)ns1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClN4O2S2/c14-10-2-1-3-11(8-10)22(19,20)16-7-6-15-13-17-12(18-21-13)9-4-5-9/h1-3,8-9,16H,4-7H2,(H,15,17,18) |
| InChIKey | UUKQSBSABAQDFI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|