C13H20ClN5O — CID 133335948
4-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidin-2-amine (PubChem CID 133335948) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133335948 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(N2CCN(CC3CCOC3)CC2)n1 |
| InChI | InChI=1S/C13H20ClN5O/c14-11-7-12(17-13(15)16-11)19-4-2-18(3-5-19)8-10-1-6-20-9-10/h7,10H,1-6,8-9H2,(H2,15,16,17) |
| InChIKey | PQLIPQOUNIQFJQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |