C16H27N3OS — CID 133336298
2-tert-butyl-N-(3-ethylsulfinylcyclohexyl)pyrimidin-4-amine (PubChem CID 133336298) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-tert-butyl-N-(3-ethylsulfinylcyclohexyl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-N-(3-ethylsulfinylcyclohexyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133336298 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-tert-butyl-N-(3-ethylsulfinylcyclohexyl)pyrimidin-4-amine |
| SMILES | CCS(=O)C1CCCC(Nc2ccnc(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C16H27N3OS/c1-5-21(20)13-8-6-7-12(11-13)18-14-9-10-17-15(19-14)16(2,3)4/h9-10,12-13H,5-8,11H2,1-4H3,(H,17,18,19) |
| InChIKey | JMYSAORBHQKHCQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |