About (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine
(Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine (PubChem CID 13333694) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine.
Molecular Properties
| Compound Name | (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine |
| PubChem CID | 13333694 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine |
| SMILES | Cc1cc(/C=C(\N)c2ccccc2)on1 |
| InChI | InChI=1S/C12H12N2O/c1-9-7-11(15-14-9)8-12(13)10-5-3-2-4-6-10/h2-8H,13H2,1H3/b12-8- |
| InChIKey | XCDGLLONROPNSK-WQLSENKSSA-N |
| XLogP | 2.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine?
The IUPAC name of (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine (CID 13333694) is (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine.
What is the SMILES notation for (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine?
The canonical SMILES for (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine is Cc1cc(/C=C(\N)c2ccccc2)on1.
What is the InChIKey of (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine?
The InChIKey is XCDGLLONROPNSK-WQLSENKSSA-N. The full InChI is InChI=1S/C12H12N2O/c1-9-7-11(15-14-9)8-12(13)10-5-3-2-4-6-10/h2-8H,13H2,1H3/b12-8-.
What are the key properties of (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine?
(Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine has a molecular weight of 200.24 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3-methyl-1,2-oxazol-5-yl)-1-phenylethenamine is sourced from PubChem (CID 13333694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).