C18H20IN5O — CID 133337359
5-ethyl-7-[4-(2-iodophenoxy)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 133337359) has the molecular formula C18H20IN5O and a molecular weight of 449.30 g/mol. Its IUPAC name is 5-ethyl-7-[4-(2-iodophenoxy)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-ethyl-7-[4-(2-iodophenoxy)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 133337359 |
| Molecular Formula | C18H20IN5O |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 5-ethyl-7-[4-(2-iodophenoxy)piperidin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCc1cc(N2CCC(Oc3ccccc3I)CC2)n2ncnc2n1 |
| InChI | InChI=1S/C18H20IN5O/c1-2-13-11-17(24-18(22-13)20-12-21-24)23-9-7-14(8-10-23)25-16-6-4-3-5-15(16)19/h3-6,11-12,14H,2,7-10H2,1H3 |
| InChIKey | ZSMZCCFRBVHXET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|