C17H24N6O4 — CID 133337677
3-(1-methoxyethyl)-5-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 133337677) has the molecular formula C17H24N6O4 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-(1-methoxyethyl)-5-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(1-methoxyethyl)-5-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133337677 |
| Molecular Formula | C17H24N6O4 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-(1-methoxyethyl)-5-[[4-(3-methyl-5-nitro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | COC(C)c1noc(CN2CCCN(c3ncc([N+](=O)[O-])cc3C)CC2)n1 |
| InChI | InChI=1S/C17H24N6O4/c1-12-9-14(23(24)25)10-18-17(12)22-6-4-5-21(7-8-22)11-15-19-16(20-27-15)13(2)26-3/h9-10,13H,4-8,11H2,1-3H3 |
| InChIKey | VEFNANDYJIOMEY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|