About (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol
(2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol (PubChem CID 133337888) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol |
| PubChem CID | 133337888 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)Nc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C15H17N3O2/c1-9(2)11(7-19)18-15-14-13(16-8-17-15)10-5-3-4-6-12(10)20-14/h3-6,8-9,11,19H,7H2,1-2H3,(H,16,17,18)/t11-/m1/s1 |
| InChIKey | ICRNWCDRCNVIKI-LLVKDONJSA-N |
| XLogP | 2.80 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol (CID 133337888) is (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol is CC(C)[C@@H](CO)Nc1ncnc2c1oc1ccccc12.
What is the InChIKey of (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol?
The InChIKey is ICRNWCDRCNVIKI-LLVKDONJSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-9(2)11(7-19)18-15-14-13(16-8-17-15)10-5-3-4-6-12(10)20-14/h3-6,8-9,11,19H,7H2,1-2H3,(H,16,17,18)/t11-/m1/s1.
What are the key properties of (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol?
(2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol has a molecular weight of 271.32 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-3-methylbutan-1-ol is sourced from PubChem (CID 133337888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).