C17H21N3O3S — CID 133338025
N-(3-ethylsulfinylcyclohexyl)-5-nitroquinolin-8-amine (PubChem CID 133338025) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-(3-ethylsulfinylcyclohexyl)-5-nitroquinolin-8-amine.
| Compound Name | N-(3-ethylsulfinylcyclohexyl)-5-nitroquinolin-8-amine |
|---|---|
| PubChem CID | 133338025 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(3-ethylsulfinylcyclohexyl)-5-nitroquinolin-8-amine |
| SMILES | CCS(=O)C1CCCC(Nc2ccc([N+](=O)[O-])c3cccnc23)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-2-24(23)13-6-3-5-12(11-13)19-15-8-9-16(20(21)22)14-7-4-10-18-17(14)15/h4,7-10,12-13,19H,2-3,5-6,11H2,1H3 |
| InChIKey | JIFHPQUPZKUGHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|