C16H15F4N3O — CID 133338759
N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133338759) has the molecular formula C16H15F4N3O and a molecular weight of 341.31 g/mol. Its IUPAC name is N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133338759 |
| Molecular Formula | C16H15F4N3O |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NCc2cccnc2OC2CCCC2)c1F |
| InChI | InChI=1S/C16H15F4N3O/c17-11-13(12(18)15(20)23-14(11)19)22-8-9-4-3-7-21-16(9)24-10-5-1-2-6-10/h3-4,7,10H,1-2,5-6,8H2,(H,22,23) |
| InChIKey | GONVARSDYGSSOE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|